Products 37051-00-6
CAS 37051-00-6 appears in our catalog under these names: Cefradine Impurity 1, Cefradine Impurity 15, Cefradine Impurity 2, Cefradine Impurity 9, 4’,5’-Dihydrocephradine. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg.
(6R,7R)-7-[[2-amino-2-(cyclohexen-1-yl)acetyl]amino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (CAS 37051-00-6) is a chemical compound with the molecular formula C16H21N3O4S and a molecular weight of 351.4 g/mol. IUPAC name: (6R,7R)-7-[[2-amino-2-(cyclohexen-1-yl)acetyl]amino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid. InChIKey: BNLDYUJJDMUOPZ-HUFXEGEASA-N.
| Molecular formula | C16H21N3O4S |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | (6R,7R)-7-[[2-amino-2-(cyclohexen-1-yl)acetyl]amino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| InChIKey | BNLDYUJJDMUOPZ-HUFXEGEASA-N |
| SMILES | CC1=C(N2[C@@H]([C@@H](C2=O)NC(=O)C(C3=CCCCC3)N)SC1)C(=O)O |
Computed by PubChem (NCBI)