CAS 370587-13-6 appears in our catalog under these names: Firefly luciferase–IN–4, Firefly luciferase-IN-4, 90.0%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 1 mg.
5-[4-(3-bromoanilino)phthalazin-1-yl]-2-methyl-N-(oxolan-2-ylmethyl)benzenesulfonamide (CAS 370587-13-6) is a chemical compound with the molecular formula C26H25BrN4O3S and a molecular weight of 553.5 g/mol. IUPAC name: 5-[4-(3-bromoanilino)phthalazin-1-yl]-2-methyl-N-(oxolan-2-ylmethyl)benzenesulfonamide. InChIKey: BUTGYOGXTZWBTP-UHFFFAOYSA-N.
| Molecular formula | C26H25BrN4O3S |
|---|---|
| Molecular weight | 553.5 g/mol |
| IUPAC name | 5-[4-(3-bromoanilino)phthalazin-1-yl]-2-methyl-N-(oxolan-2-ylmethyl)benzenesulfonamide |
| InChIKey | BUTGYOGXTZWBTP-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C2=NN=C(C3=CC=CC=C32)NC4=CC(=CC=C4)Br)S(=O)(=O)NCC5CCCO5 |
Computed by PubChem (NCBI)