CAS 37083-35-5 is the registry number for 5,10,15,20-Tetrakis(2-chlorophenyl)porphyrin, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5,10,15,20-tetrakis(2-chlorophenyl)-21,23-dihydroporphyrin (CAS 37083-35-5) is a chemical compound with the molecular formula C44H26Cl4N4 and a molecular weight of 752.5 g/mol. IUPAC name: 5,10,15,20-tetrakis(2-chlorophenyl)-21,23-dihydroporphyrin. InChIKey: GEHPICAZCITNQL-UHFFFAOYSA-N.
| Molecular formula | C44H26Cl4N4 |
|---|---|
| Molecular weight | 752.5 g/mol |
| IUPAC name | 5,10,15,20-tetrakis(2-chlorophenyl)-21,23-dihydroporphyrin |
| InChIKey | GEHPICAZCITNQL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=C3C=CC(=C(C4=NC(=C(C5=CC=C(N5)C(=C6C=CC2=N6)C7=CC=CC=C7Cl)C8=CC=CC=C8Cl)C=C4)C9=CC=CC=C9Cl)N3)Cl |
Computed by PubChem (NCBI)