CAS 370871-42-4 is the registry number for 7030B-C5, 99.78%. Offered by: MedChemExpress. Available pack sizes: 100 mg, 5 mg, 10mM/1mL, 25 mg, 50 mg, 10 mg.
8-(2-hydroxyethylamino)-7-[(3-methoxyphenyl)methyl]-1,3-dimethylpurine-2,6-dione (CAS 370871-42-4) is a chemical compound with the molecular formula C17H21N5O4 and a molecular weight of 359.4 g/mol. IUPAC name: 8-(2-hydroxyethylamino)-7-[(3-methoxyphenyl)methyl]-1,3-dimethylpurine-2,6-dione. InChIKey: ZIVVJVCKDAXYLK-UHFFFAOYSA-N.
| Molecular formula | C17H21N5O4 |
|---|---|
| Molecular weight | 359.4 g/mol |
| IUPAC name | 8-(2-hydroxyethylamino)-7-[(3-methoxyphenyl)methyl]-1,3-dimethylpurine-2,6-dione |
| InChIKey | ZIVVJVCKDAXYLK-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=O)N(C1=O)C)N(C(=N2)NCCO)CC3=CC(=CC=C3)OC |
Computed by PubChem (NCBI)