CAS 370882-99-8 appears in our catalog under these names: (1R,6S)-tert-Butyl 3,8-diazabicyclo(4.2.0)octane-3-carboxylate, 95+%, (1R,6S)–3–Boc–3,8–diazabicyclo(4·2·0)octane, (1R,6S)-TERT-BUTYL 3,8-DIAZABICYCLO[4.2.0]OCTANE-3-CARBOXYLATE, >95%. Offered by: AmBeed, GLPBio, Fluorochem. Available pack sizes: 1g, 250mg.
Tert-butyl (1R,6S)-3,8-diazabicyclo[4.2.0]octane-3-carboxylate (CAS 370882-99-8) is a chemical compound with the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. IUPAC name: tert-butyl (1R,6S)-3,8-diazabicyclo[4.2.0]octane-3-carboxylate. InChIKey: VGJOEEIXDPWTAZ-IUCAKERBSA-N.
| Molecular formula | C11H20N2O2 |
|---|---|
| Molecular weight | 212.29 g/mol |
| IUPAC name | tert-butyl (1R,6S)-3,8-diazabicyclo[4.2.0]octane-3-carboxylate |
| InChIKey | VGJOEEIXDPWTAZ-IUCAKERBSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]2CN[C@H]2C1 |
Computed by PubChem (NCBI)