CAS 3709-43-1 appears in our catalog under these names: 4,4'-Dinitrostilbene-2,2'-disulfonic acid disodium salt, 95%, DNDS disodium, 95%, DNDS/ 99.88% (existing batch purity), DNDS disodium, Disodium 4,4'-Dinitrostilbene-2,2'-disulfonate, >98.0%(HPLC)(T). Offered by: Combi-blocks, AmBeed, TargetMol, GLPBio, TCI. Available pack sizes: 5g, 100g, 25g, 1g, 500g, 10g, 15g, 50g.
Disodium;5-nitro-2-[(E)-2-(4-nitro-2-sulfonatophenyl)ethenyl]benzenesulfonate (CAS 3709-43-1) is a chemical compound with the molecular formula C14H8N2Na2O10S2 and a molecular weight of 474.3 g/mol. IUPAC name: disodium;5-nitro-2-[(E)-2-(4-nitro-2-sulfonatophenyl)ethenyl]benzenesulfonate. InChIKey: SDCDTWFAOKXZHD-SEPHDYHBSA-L.
| Molecular formula | C14H8N2Na2O10S2 |
|---|---|
| Molecular weight | 474.3 g/mol |
| IUPAC name | disodium;5-nitro-2-[(E)-2-(4-nitro-2-sulfonatophenyl)ethenyl]benzenesulfonate |
| InChIKey | SDCDTWFAOKXZHD-SEPHDYHBSA-L |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])S(=O)(=O)[O-])/C=C/C2=C(C=C(C=C2)[N+](=O)[O-])S(=O)(=O)[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)