Products 371150-44-6

CAS 371150-44-6 appears in our catalog under these names: Bis(2-methoxyethyl)sulfamoyl chloride, 95%, Bis(2-Methoxyethyl)sulfamoyl chloride, 93%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

N,N-bis(2-methoxyethyl)sulfamoyl chloride (CAS 371150-44-6) is a chemical compound with the molecular formula C6H14ClNO4S and a molecular weight of 231.70 g/mol. IUPAC name: N,N-bis(2-methoxyethyl)sulfamoyl chloride. InChIKey: WMAWCYCQPBJFKY-UHFFFAOYSA-N.

Identity
Molecular formulaC6H14ClNO4S
Molecular weight231.70 g/mol
IUPAC nameN,N-bis(2-methoxyethyl)sulfamoyl chloride
InChIKeyWMAWCYCQPBJFKY-UHFFFAOYSA-N
SMILESCOCCN(CCOC)S(=O)(=O)Cl

Computed by PubChem (NCBI)