CAS 371162-53-7 appears in our catalog under these names: Lithium tetrakis(pentafluorophenyl)borate ethyl etherate, 96.00%, Lithium tetrakis(pentafluorophenyl)borate ethyl etherate. Offered by: Chemat, Biosynth, Thermo Scientific (Acros). Available pack sizes: 100mg, 10g, 1g, 50mg, 250mg, 1000mg, 500mg.
Lithium;ethoxyethane;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (CAS 371162-53-7) is a chemical compound with the molecular formula C28H10BF20LiO and a molecular weight of 760.1 g/mol. IUPAC name: lithium;ethoxyethane;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide. InChIKey: KPLZKJQZPFREPG-UHFFFAOYSA-N.
| Molecular formula | C28H10BF20LiO |
|---|---|
| Molecular weight | 760.1 g/mol |
| IUPAC name | lithium;ethoxyethane;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| InChIKey | KPLZKJQZPFREPG-UHFFFAOYSA-N |
| SMILES | [Li+].[B-](C1=C(C(=C(C(=C1F)F)F)F)F)(C2=C(C(=C(C(=C2F)F)F)F)F)(C3=C(C(=C(C(=C3F)F)F)F)F)C4=C(C(=C(C(=C4F)F)F)F)F.CCOCC |
Computed by PubChem (NCBI)