CAS 37132-68-6 appears in our catalog under these names: 3-Aminobenzamidine dihydrochloride, 96%, 3-Aminobenzamidine dihydrochloride hydrate, 95%, 3-Aminobenzamidine dihydrochloride hydrate, 96%, 3-Aminobenzamidine Dihydrochloride. Offered by: Combi-blocks, TRC. Available pack sizes: 10g, 25g, 5g, 1g, 500mg.
3-aminobenzenecarboximidamide;dihydrochloride (CAS 37132-68-6) is a chemical compound with the molecular formula C7H11Cl2N3 and a molecular weight of 208.09 g/mol. IUPAC name: 3-aminobenzenecarboximidamide;dihydrochloride. InChIKey: FKFMMMVFFYPIEE-UHFFFAOYSA-N.
| Molecular formula | C7H11Cl2N3 |
|---|---|
| Molecular weight | 208.09 g/mol |
| IUPAC name | 3-aminobenzenecarboximidamide;dihydrochloride |
| InChIKey | FKFMMMVFFYPIEE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)C(=N)N.Cl.Cl |
Computed by PubChem (NCBI)