Products 3715-64-8

CAS 3715-64-8 is the registry number for 3`-Deoxy-5`-thymidylic Acid. Offered by: TRC. Available pack sizes: 250mg.

Structural formula: {0} (CAS {1})

[(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl dihydrogen phosphate (CAS 3715-64-8) is a chemical compound with the molecular formula C10H15N2O7P and a molecular weight of 306.21 g/mol. IUPAC name: [(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl dihydrogen phosphate. InChIKey: WVNRRNJFRREKAR-JGVFFNPUSA-N.

Identity
Molecular formulaC10H15N2O7P
Molecular weight306.21 g/mol
IUPAC name[(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl dihydrogen phosphate
InChIKeyWVNRRNJFRREKAR-JGVFFNPUSA-N
SMILESCC1=CN(C(=O)NC1=O)[C@H]2CC[C@H](O2)COP(=O)(O)O

Computed by PubChem (NCBI)