CAS 37151-17-0 is the registry number for 2-(p-methoxyphenyl)adenosine, 98%, 98%. Offered by: Chemat. Available pack sizes: 5mg, 25mg.
2-[6-amino-2-(4-methoxyphenyl)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (CAS 37151-17-0) is a chemical compound with the molecular formula C17H19N5O5 and a molecular weight of 373.4 g/mol. IUPAC name: 2-[6-amino-2-(4-methoxyphenyl)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol. InChIKey: VKSRAKNPXOTFAX-UHFFFAOYSA-N.
| Molecular formula | C17H19N5O5 |
|---|---|
| Molecular weight | 373.4 g/mol |
| IUPAC name | 2-[6-amino-2-(4-methoxyphenyl)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| InChIKey | VKSRAKNPXOTFAX-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=NC(=C3C(=N2)N(C=N3)C4C(C(C(O4)CO)O)O)N |
Computed by PubChem (NCBI)