CAS 37153-52-9 appears in our catalog under these names: Clenbuterol EP Impurity F, Clenbuterol Impurity 6(Clenbuterol EP Impurity F), Bromoclenbuterol. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
1-(4-amino-3-bromo-5-chlorophenyl)-2-(tert-butylamino)ethanol (CAS 37153-52-9) is a chemical compound with the molecular formula C12H18BrClN2O and a molecular weight of 321.64 g/mol. IUPAC name: 1-(4-amino-3-bromo-5-chlorophenyl)-2-(tert-butylamino)ethanol. InChIKey: RBROAKIHDILEQG-UHFFFAOYSA-N.
| Molecular formula | C12H18BrClN2O |
|---|---|
| Molecular weight | 321.64 g/mol |
| IUPAC name | 1-(4-amino-3-bromo-5-chlorophenyl)-2-(tert-butylamino)ethanol |
| InChIKey | RBROAKIHDILEQG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NCC(C1=CC(=C(C(=C1)Br)N)Cl)O |
Computed by PubChem (NCBI)