CAS 37162-89-3 appears in our catalog under these names: Clenbuterol-hydroxymethyl hydrochloride 100 µg/mL in Acetonitrile, Hydroxymethylclenbuterol hydrochloride, Concentration: 100 µg/ml Solvent: Acetonitrile, Hydroxymethylclenbuterol hydrochloride. Offered by: Dr. Ehrenstorfer, HPC Standards. Available pack sizes: 1ml, 1x1ml, 1x10mg.
2-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]-2-methylpropan-1-ol;hydrochloride (CAS 37162-89-3) is a chemical compound with the molecular formula C12H19Cl3N2O2 and a molecular weight of 329.6 g/mol. IUPAC name: 2-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]-2-methylpropan-1-ol;hydrochloride. InChIKey: INXMPUPHELAAAW-UHFFFAOYSA-N.
| Molecular formula | C12H19Cl3N2O2 |
|---|---|
| Molecular weight | 329.6 g/mol |
| IUPAC name | 2-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]-2-methylpropan-1-ol;hydrochloride |
| InChIKey | INXMPUPHELAAAW-UHFFFAOYSA-N |
| SMILES | CC(C)(CO)NCC(C1=CC(=C(C(=C1)Cl)N)Cl)O.Cl |
Computed by PubChem (NCBI)