CAS 37162-93-9 appears in our catalog under these names: Clenhexyl (hydrochloride), Clenhexyl hydrochloride, Clenhexyl hydrochloride, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: MedChemExpress, HPC Standards. Available pack sizes: Get quote, 1x10mg, 1x1ml.
1-(4-amino-3,5-dichlorophenyl)-2-(cyclohexylamino)ethanol;hydrochloride (CAS 37162-93-9) is a chemical compound with the molecular formula C14H21Cl3N2O and a molecular weight of 339.7 g/mol. IUPAC name: 1-(4-amino-3,5-dichlorophenyl)-2-(cyclohexylamino)ethanol;hydrochloride. InChIKey: NIEFTTTUMIPUES-UHFFFAOYSA-N.
| Molecular formula | C14H21Cl3N2O |
|---|---|
| Molecular weight | 339.7 g/mol |
| IUPAC name | 1-(4-amino-3,5-dichlorophenyl)-2-(cyclohexylamino)ethanol;hydrochloride |
| InChIKey | NIEFTTTUMIPUES-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)NCC(C2=CC(=C(C(=C2)Cl)N)Cl)O.Cl |
Computed by PubChem (NCBI)