CAS 37164-19-5 appears in our catalog under these names: Ethylene-d4 Diamine, >95% (GC), Ethylene-d4-diamine, 98 atom % D, min 98% Chemical Purity, Ethylene–d4–diamine, ETHYLENE-D4-DIAMINE, 98 ATOM % D, 98% CP, Ethylene-d4-diamine, 99.2%. Offered by: TRC, CDN, GLPBio, Sigma-Aldrich, MedChemExpress. Available pack sizes: 250mg, 500mg, 50mg, 1g, 0,5g, 100 mg, 50 mg.
1,1,2,2-tetradeuterioethane-1,2-diamine (CAS 37164-19-5) is a chemical compound with the molecular formula C2H8N2 and a molecular weight of 64.12 g/mol. IUPAC name: 1,1,2,2-tetradeuterioethane-1,2-diamine. InChIKey: PIICEJLVQHRZGT-LNLMKGTHSA-N.
| Molecular formula | C2H8N2 |
|---|---|
| Molecular weight | 64.12 g/mol |
| IUPAC name | 1,1,2,2-tetradeuterioethane-1,2-diamine |
| InChIKey | PIICEJLVQHRZGT-LNLMKGTHSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])N)N |
Computed by PubChem (NCBI)