CAS 371775-71-2 appears in our catalog under these names: Rosuvastatin Impurity 108, 5-Hydroxyde((3R,5R)-3,5-dihydroxyhexanoate) Rosuvastatin. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 1g.
N-[4-(4-fluorophenyl)-5-(hydroxymethyl)-6-propan-2-ylpyrimidin-2-yl]methanesulfonamide (CAS 371775-71-2) is a chemical compound with the molecular formula C15H18FN3O3S and a molecular weight of 339.4 g/mol. IUPAC name: N-[4-(4-fluorophenyl)-5-(hydroxymethyl)-6-propan-2-ylpyrimidin-2-yl]methanesulfonamide. InChIKey: SEWYEEYQONHWOV-UHFFFAOYSA-N.
| Molecular formula | C15H18FN3O3S |
|---|---|
| Molecular weight | 339.4 g/mol |
| IUPAC name | N-[4-(4-fluorophenyl)-5-(hydroxymethyl)-6-propan-2-ylpyrimidin-2-yl]methanesulfonamide |
| InChIKey | SEWYEEYQONHWOV-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NC(=NC(=C1CO)C2=CC=C(C=C2)F)NS(=O)(=O)C |
Computed by PubChem (NCBI)