CAS 371786-11-7 appears in our catalog under these names: 1,5,9–Triphenylenetriamine, Triphenylene-1,5,9-triamine 97%, Triphenylene-1,5,9-triamine, 97%, 97%, 1,5,9-Triphenylenetriamine, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 50mg, 100mg, 1g.
Triphenylene-1,5,9-triamine (CAS 371786-11-7) is a chemical compound with the molecular formula C18H15N3 and a molecular weight of 273.3 g/mol. IUPAC name: triphenylene-1,5,9-triamine. InChIKey: TXQXBGIHSVUGNV-UHFFFAOYSA-N.
| Molecular formula | C18H15N3 |
|---|---|
| Molecular weight | 273.3 g/mol |
| IUPAC name | triphenylene-1,5,9-triamine |
| InChIKey | TXQXBGIHSVUGNV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C4C(=C2C(=C1)N)C=CC=C4N)C=CC=C3N |
Computed by PubChem (NCBI)