CAS 371962-01-5 appears in our catalog under these names: ZAPA sulfate, ZAPA Sulfate, ZAPA sulfate 99%, ZAPA (sulfate), 99.25%, ZAPA (sulfate) (Standard). Offered by: GLPBio, TRC, Ambeed, MedChemExpress. Available pack sizes: 5mg, 100mg, 500mg, 10mg, 25mg, 50mg, 250mg, 1g.
(Z)-3-carbamimidoylsulfanylprop-2-enoic acid;sulfuric acid (CAS 371962-01-5) is a chemical compound with the molecular formula C4H8N2O6S2 and a molecular weight of 244.3 g/mol. IUPAC name: (Z)-3-carbamimidoylsulfanylprop-2-enoic acid;sulfuric acid. InChIKey: UWVNHPNVOMFDHW-ODZAUARKSA-N.
| Molecular formula | C4H8N2O6S2 |
|---|---|
| Molecular weight | 244.3 g/mol |
| IUPAC name | (Z)-3-carbamimidoylsulfanylprop-2-enoic acid;sulfuric acid |
| InChIKey | UWVNHPNVOMFDHW-ODZAUARKSA-N |
| SMILES | C(=C\SC(=N)N)\C(=O)O.OS(=O)(=O)O |
Computed by PubChem (NCBI)