CAS 371971-12-9 is the registry number for 1-(6-(Benzyloxy)-1H-indol-3-yl)-2,2,2-trichloroethan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2,2-trichloro-1-(6-phenylmethoxy-1H-indol-3-yl)ethanone (CAS 371971-12-9) is a chemical compound with the molecular formula C17H12Cl3NO2 and a molecular weight of 368.6 g/mol. IUPAC name: 2,2,2-trichloro-1-(6-phenylmethoxy-1H-indol-3-yl)ethanone. InChIKey: LVIKNXGQIFQRAL-UHFFFAOYSA-N.
| Molecular formula | C17H12Cl3NO2 |
|---|---|
| Molecular weight | 368.6 g/mol |
| IUPAC name | 2,2,2-trichloro-1-(6-phenylmethoxy-1H-indol-3-yl)ethanone |
| InChIKey | LVIKNXGQIFQRAL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC3=C(C=C2)C(=CN3)C(=O)C(Cl)(Cl)Cl |
Computed by PubChem (NCBI)