CAS 372117-76-5 appears in our catalog under these names: Avanafil Impurity 76, Avanafil Impurity 57, Ethyl 4-((3-chloro-4-methoxybenzyl)amino)-2-(methylsulfonyl)pyrimidine-5-carboxylate 97%. Offered by: Hubei YoungXin, Chemat Brand, Ambeed. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request, 250mg, 1g.
Ethyl 4-[(3-chloro-4-methoxyphenyl)methylamino]-2-methylsulfonylpyrimidine-5-carboxylate (CAS 372117-76-5) is a chemical compound with the molecular formula C16H18ClN3O5S and a molecular weight of 399.8 g/mol. IUPAC name: ethyl 4-[(3-chloro-4-methoxyphenyl)methylamino]-2-methylsulfonylpyrimidine-5-carboxylate. InChIKey: UWNNSGFFWARCDW-UHFFFAOYSA-N.
| Molecular formula | C16H18ClN3O5S |
|---|---|
| Molecular weight | 399.8 g/mol |
| IUPAC name | ethyl 4-[(3-chloro-4-methoxyphenyl)methylamino]-2-methylsulfonylpyrimidine-5-carboxylate |
| InChIKey | UWNNSGFFWARCDW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C(N=C1NCC2=CC(=C(C=C2)OC)Cl)S(=O)(=O)C |
Computed by PubChem (NCBI)