CAS 372183-89-6 is the registry number for 2-(Pyridin-4-yl)cyclopropanecarbaldehyde, 85%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
Cis-(1R,2R)-2-pyridin-4-ylcyclopropane-1-carbaldehyde (CAS 372183-89-6) is a chemical compound with the molecular formula C9H9NO and a molecular weight of 147.17 g/mol. IUPAC name: cis-(1R,2R)-2-pyridin-4-ylcyclopropane-1-carbaldehyde. InChIKey: AAYIHILOKBYQEP-IUCAKERBSA-N.
| Molecular formula | C9H9NO |
|---|---|
| Molecular weight | 147.17 g/mol |
| IUPAC name | cis-(1R,2R)-2-pyridin-4-ylcyclopropane-1-carbaldehyde |
| InChIKey | AAYIHILOKBYQEP-IUCAKERBSA-N |
| SMILES | C1[C@H]([C@@H]1C2=CC=NC=C2)C=O |
Computed by PubChem (NCBI)