CAS 372490-43-2 appears in our catalog under these names: 1,3-Diphenyl-1h-pyrazole-4-carboxylic acid hydrazide, 95%, 1,3-Diphenyl-1H-pyrazole-4-carbohydrazide, 95%, 1,3-Diphenyl-1H-pyrazole-4-carbohydrazide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
1,3-diphenylpyrazole-4-carbohydrazide (CAS 372490-43-2) is a chemical compound with the molecular formula C16H14N4O and a molecular weight of 278.31 g/mol. IUPAC name: 1,3-diphenylpyrazole-4-carbohydrazide. InChIKey: HYWOFZAKNCIVFB-UHFFFAOYSA-N.
| Molecular formula | C16H14N4O |
|---|---|
| Molecular weight | 278.31 g/mol |
| IUPAC name | 1,3-diphenylpyrazole-4-carbohydrazide |
| InChIKey | HYWOFZAKNCIVFB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN(C=C2C(=O)NN)C3=CC=CC=C3 |
Computed by PubChem (NCBI)