Products 373370-73-1
CAS 373370-73-1 is the registry number for MitoBloCK-1, 98.87%. Offered by: MedChemExpress. Available pack sizes: 50 mg, 25 mg, 10 mg, 100 mg, 5 mg.
[(3-bromo-2-hydroxy-6,7,8,9-tetrahydrodibenzofuran-1-yl)methylideneamino]thiourea (CAS 373370-73-1) is a chemical compound with the molecular formula C14H14BrN3O2S and a molecular weight of 368.25 g/mol. IUPAC name: [(3-bromo-2-hydroxy-6,7,8,9-tetrahydrodibenzofuran-1-yl)methylideneamino]thiourea. InChIKey: VBDLLTJWFFBEAG-UHFFFAOYSA-N.
| Molecular formula | C14H14BrN3O2S |
|---|---|
| Molecular weight | 368.25 g/mol |
| IUPAC name | [(3-bromo-2-hydroxy-6,7,8,9-tetrahydrodibenzofuran-1-yl)methylideneamino]thiourea |
| InChIKey | VBDLLTJWFFBEAG-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C3=C(C(=C(C=C3O2)Br)O)C=NNC(=S)N |
Computed by PubChem (NCBI)