CAS 37398-25-7 is the registry number for Bis(2-benzyloxy-3-nitrophenyl)disulfide, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 250mg, 500mg.
1-nitro-3-[(3-nitro-2-phenylmethoxyphenyl)disulfanyl]-2-phenylmethoxybenzene (CAS 37398-25-7) is a chemical compound with the molecular formula C26H20N2O6S2 and a molecular weight of 520.6 g/mol. IUPAC name: 1-nitro-3-[(3-nitro-2-phenylmethoxyphenyl)disulfanyl]-2-phenylmethoxybenzene. InChIKey: OQWRELPZIJGMOJ-UHFFFAOYSA-N.
| Molecular formula | C26H20N2O6S2 |
|---|---|
| Molecular weight | 520.6 g/mol |
| IUPAC name | 1-nitro-3-[(3-nitro-2-phenylmethoxyphenyl)disulfanyl]-2-phenylmethoxybenzene |
| InChIKey | OQWRELPZIJGMOJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=CC=C2SSC3=CC=CC(=C3OCC4=CC=CC=C4)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)