Products 374-88-9

CAS 374-88-9 is the registry number for Perfluorocyclohexanecarboxylic acid, 97%. Offered by: Fluorochem. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane-1-carboxylic acid (CAS 374-88-9) is a chemical compound with the molecular formula C7HF11O2 and a molecular weight of 326.06 g/mol. IUPAC name: 1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane-1-carboxylic acid. InChIKey: VTXSVMHCHVIRJR-UHFFFAOYSA-N.

Identity
Molecular formulaC7HF11O2
Molecular weight326.06 g/mol
IUPAC name1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane-1-carboxylic acid
InChIKeyVTXSVMHCHVIRJR-UHFFFAOYSA-N
SMILESC(=O)(C1(C(C(C(C(C1(F)F)(F)F)(F)F)(F)F)(F)F)F)O

Computed by PubChem (NCBI)