CAS 374-88-9 is the registry number for Perfluorocyclohexanecarboxylic acid, 97%. Offered by: Fluorochem. Available pack sizes: 250mg, 1g.
1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane-1-carboxylic acid (CAS 374-88-9) is a chemical compound with the molecular formula C7HF11O2 and a molecular weight of 326.06 g/mol. IUPAC name: 1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane-1-carboxylic acid. InChIKey: VTXSVMHCHVIRJR-UHFFFAOYSA-N.
| Molecular formula | C7HF11O2 |
|---|---|
| Molecular weight | 326.06 g/mol |
| IUPAC name | 1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane-1-carboxylic acid |
| InChIKey | VTXSVMHCHVIRJR-UHFFFAOYSA-N |
| SMILES | C(=O)(C1(C(C(C(C(C1(F)F)(F)F)(F)F)(F)F)(F)F)F)O |
Computed by PubChem (NCBI)