Products 37402-63-4
CAS 37402-63-4 is the registry number for O-Acetyl-3-(acetyloxy)-N-Boc-L-tyrosine, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2S)-3-(3,4-diacetyloxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 37402-63-4) is a chemical compound with the molecular formula C18H23NO8 and a molecular weight of 381.4 g/mol. IUPAC name: (2S)-3-(3,4-diacetyloxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: STACXKDHXDXGGG-ZDUSSCGKSA-N.
| Molecular formula | C18H23NO8 |
|---|---|
| Molecular weight | 381.4 g/mol |
| IUPAC name | (2S)-3-(3,4-diacetyloxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | STACXKDHXDXGGG-ZDUSSCGKSA-N |
| SMILES | CC(=O)OC1=C(C=C(C=C1)C[C@@H](C(=O)O)NC(=O)OC(C)(C)C)OC(=O)C |
Computed by PubChem (NCBI)