Products 374072-83-0
CAS 374072-83-0 appears in our catalog under these names: 1,1'-(4-(tert-Butyl)pyridine-2,6-diyl)diethanone, 97%, 97%, 1,1'-(4-(tert-Butyl)pyridine-2,6-diyl)diethanone, 97%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
1-(6-acetyl-4-tert-butyl-2-pyridinyl)ethanone (CAS 374072-83-0) is a chemical compound with the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. IUPAC name: 1-(6-acetyl-4-tert-butyl-2-pyridinyl)ethanone. InChIKey: DLGFXGKOQJVJDD-UHFFFAOYSA-N.
| Molecular formula | C13H17NO2 |
|---|---|
| Molecular weight | 219.28 g/mol |
| IUPAC name | 1-(6-acetyl-4-tert-butyl-2-pyridinyl)ethanone |
| InChIKey | DLGFXGKOQJVJDD-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=CC(=N1)C(=O)C)C(C)(C)C |
Computed by PubChem (NCBI)