Products 374543-46-1
CAS 374543-46-1 is the registry number for SARS-CoV-2-IN-100. Offered by: MedChemExpress. Available pack sizes: Get quote.
10-(4-methylphenyl)-7-phenyl-6,7,8,10-tetrahydro-5H-indeno[1,2-b]quinoline-9,11-dione (CAS 374543-46-1) is a chemical compound with the molecular formula C29H23NO2 and a molecular weight of 417.5 g/mol. IUPAC name: 10-(4-methylphenyl)-7-phenyl-6,7,8,10-tetrahydro-5H-indeno[1,2-b]quinoline-9,11-dione. InChIKey: YYLIGNJEXNIHPT-UHFFFAOYSA-N.
| Molecular formula | C29H23NO2 |
|---|---|
| Molecular weight | 417.5 g/mol |
| IUPAC name | 10-(4-methylphenyl)-7-phenyl-6,7,8,10-tetrahydro-5H-indeno[1,2-b]quinoline-9,11-dione |
| InChIKey | YYLIGNJEXNIHPT-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2C3=C(CC(CC3=O)C4=CC=CC=C4)NC5=C2C(=O)C6=CC=CC=C65 |
Computed by PubChem (NCBI)