CAS 37455-87-1 is the registry number for 2,4-Dihydroxy-6-propylbenzaldehyde. Offered by: TRC, Biosynth. Available pack sizes: 1g, 10g.
2,4-dihydroxy-6-propylbenzaldehyde (CAS 37455-87-1) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. IUPAC name: 2,4-dihydroxy-6-propylbenzaldehyde. InChIKey: UZIMQJKPLFIOJN-UHFFFAOYSA-N.
| Molecular formula | C10H12O3 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | 2,4-dihydroxy-6-propylbenzaldehyde |
| InChIKey | UZIMQJKPLFIOJN-UHFFFAOYSA-N |
| SMILES | CCCC1=C(C(=CC(=C1)O)O)C=O |
Computed by PubChem (NCBI)