CAS 37466-21-0 appears in our catalog under these names: Aspirin–L–argininie, L-Arginine (arginine). Offered by: GLPBio, MedChemExpress. Available pack sizes: 500mg, Get quote.
2-acetyloxybenzoic acid;(2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid (CAS 37466-21-0) is a chemical compound with the molecular formula C15H22N4O6 and a molecular weight of 354.36 g/mol. IUPAC name: 2-acetyloxybenzoic acid;(2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid. InChIKey: FXXXGQLMXDIPQA-VWMHFEHESA-N.
| Molecular formula | C15H22N4O6 |
|---|---|
| Molecular weight | 354.36 g/mol |
| IUPAC name | 2-acetyloxybenzoic acid;(2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid |
| InChIKey | FXXXGQLMXDIPQA-VWMHFEHESA-N |
| SMILES | CC(=O)OC1=CC=CC=C1C(=O)O.C(C[C@@H](C(=O)O)N)CN=C(N)N |
Computed by PubChem (NCBI)