CAS 374692-91-8 is the registry number for 5,5',5''-(1,3,5-triazine-2,4,6-triyl)tris(thiophen-2-amine), 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
5-[4,6-bis(5-aminothiophen-2-yl)-1,3,5-triazin-2-yl]thiophen-2-amine (CAS 374692-91-8) is a chemical compound with the molecular formula C15H12N6S3 and a molecular weight of 372.5 g/mol. IUPAC name: 5-[4,6-bis(5-aminothiophen-2-yl)-1,3,5-triazin-2-yl]thiophen-2-amine. InChIKey: PTGNZVOEBQOQRW-UHFFFAOYSA-N.
| Molecular formula | C15H12N6S3 |
|---|---|
| Molecular weight | 372.5 g/mol |
| IUPAC name | 5-[4,6-bis(5-aminothiophen-2-yl)-1,3,5-triazin-2-yl]thiophen-2-amine |
| InChIKey | PTGNZVOEBQOQRW-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1)N)C2=NC(=NC(=N2)C3=CC=C(S3)N)C4=CC=C(S4)N |
Computed by PubChem (NCBI)