CAS 37470-42-1 appears in our catalog under these names: 1-(4-Ethoxy-2-hydroxyphenyl)ethan-1-one, 97%, 4'-Ethoxy-2'-hydroxyacetophenone, 95%, 4′-Ethoxy-2′-hydroxyacetophenone, 97%, 97%. Offered by: Fluorochem, Combi-blocks, Chemat. Available pack sizes: 5g, 1g, 250mg.
1-(4-ethoxy-2-hydroxyphenyl)ethanone (CAS 37470-42-1) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. IUPAC name: 1-(4-ethoxy-2-hydroxyphenyl)ethanone. InChIKey: VBLALYJSGGGWHU-UHFFFAOYSA-N.
| Molecular formula | C10H12O3 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | 1-(4-ethoxy-2-hydroxyphenyl)ethanone |
| InChIKey | VBLALYJSGGGWHU-UHFFFAOYSA-N |
| SMILES | CCOC1=CC(=C(C=C1)C(=O)C)O |
Computed by PubChem (NCBI)