CAS 374794-75-9 appears in our catalog under these names: Trans-3-hydroxy-4-methylpiperidine-1-carboxylic acid tert-butyl ester, 97%, trans-tert-Butyl 3-hydroxy-4-methylpiperidine-1-carboxylate, 97%, trans-1-Boc-3-Hydroxy-4-methylpiperidine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 5g, 25g, 2,5g.
Tert-butyl (3S,4R)-3-hydroxy-4-methylpiperidine-1-carboxylate (CAS 374794-75-9) is a chemical compound with the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. IUPAC name: tert-butyl (3S,4R)-3-hydroxy-4-methylpiperidine-1-carboxylate. InChIKey: ADHBFIMXBSFQLJ-RKDXNWHRSA-N.
| Molecular formula | C11H21NO3 |
|---|---|
| Molecular weight | 215.29 g/mol |
| IUPAC name | tert-butyl (3S,4R)-3-hydroxy-4-methylpiperidine-1-carboxylate |
| InChIKey | ADHBFIMXBSFQLJ-RKDXNWHRSA-N |
| SMILES | C[C@@H]1CCN(C[C@H]1O)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)