CAS 374818-58-3 appears in our catalog under these names: 3–(5–Fluoro–1H–indol–3–yl)–1H–pyrrole–2,5–dione, 3-(5-Fluoro-1h-indol-3-yl)-1h-pyrrole-2,5-dione, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
3-(5-fluoro-1H-indol-3-yl)pyrrole-2,5-dione (CAS 374818-58-3) is a chemical compound with the molecular formula C12H7FN2O2 and a molecular weight of 230.19 g/mol. IUPAC name: 3-(5-fluoro-1H-indol-3-yl)pyrrole-2,5-dione. InChIKey: DGNXMTOBIIMAMH-UHFFFAOYSA-N.
| Molecular formula | C12H7FN2O2 |
|---|---|
| Molecular weight | 230.19 g/mol |
| IUPAC name | 3-(5-fluoro-1H-indol-3-yl)pyrrole-2,5-dione |
| InChIKey | DGNXMTOBIIMAMH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)C(=CN2)C3=CC(=O)NC3=O |
Computed by PubChem (NCBI)