CAS 374886-51-8 appears in our catalog under these names: ASP 2535, ASP2535, ASP2535, 99.70%, 99.70%, ASP2535, 99.44%. Offered by: TRC, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 500mg, 10mg, 5mg, 25mg, 50mg, 1mg, 10mM/1mL, 5 mg.
4-[3-(6-phenyl-3-pyridinyl)-5-propan-2-yl-1,2,4-triazol-4-yl]-2,1,3-benzoxadiazole (CAS 374886-51-8) is a chemical compound with the molecular formula C22H18N6O and a molecular weight of 382.4 g/mol. IUPAC name: 4-[3-(6-phenyl-3-pyridinyl)-5-propan-2-yl-1,2,4-triazol-4-yl]-2,1,3-benzoxadiazole. InChIKey: FQGLDGKVKDPVLO-UHFFFAOYSA-N.
| Molecular formula | C22H18N6O |
|---|---|
| Molecular weight | 382.4 g/mol |
| IUPAC name | 4-[3-(6-phenyl-3-pyridinyl)-5-propan-2-yl-1,2,4-triazol-4-yl]-2,1,3-benzoxadiazole |
| InChIKey | FQGLDGKVKDPVLO-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NN=C(N1C2=CC=CC3=NON=C32)C4=CN=C(C=C4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)