CAS 375-26-8 is the registry number for 2,3-Dibromooctafluorobutane, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g.
2,3-dibromo-1,1,1,2,3,4,4,4-octafluorobutane (CAS 375-26-8) is a chemical compound with the molecular formula C4Br2F8 and a molecular weight of 359.84 g/mol. IUPAC name: 2,3-dibromo-1,1,1,2,3,4,4,4-octafluorobutane. InChIKey: WDEZAGXZUSQBLW-UHFFFAOYSA-N.
| Molecular formula | C4Br2F8 |
|---|---|
| Molecular weight | 359.84 g/mol |
| IUPAC name | 2,3-dibromo-1,1,1,2,3,4,4,4-octafluorobutane |
| InChIKey | WDEZAGXZUSQBLW-UHFFFAOYSA-N |
| SMILES | C(C(C(F)(F)F)(F)Br)(C(F)(F)F)(F)Br |
Computed by PubChem (NCBI)