CAS 375-46-2 is the registry number for 1,2,4,4,4-Pentachloropentafluorobutane, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1,1,1,3,4-pentachloro-2,2,3,4,4-pentafluorobutane (CAS 375-46-2) is a chemical compound with the molecular formula C4Cl5F5 and a molecular weight of 320.3 g/mol. IUPAC name: 1,1,1,3,4-pentachloro-2,2,3,4,4-pentafluorobutane. InChIKey: QXPPGHDQTVKTDY-UHFFFAOYSA-N.
| Molecular formula | C4Cl5F5 |
|---|---|
| Molecular weight | 320.3 g/mol |
| IUPAC name | 1,1,1,3,4-pentachloro-2,2,3,4,4-pentafluorobutane |
| InChIKey | QXPPGHDQTVKTDY-UHFFFAOYSA-N |
| SMILES | C(C(C(F)(F)Cl)(F)Cl)(C(Cl)(Cl)Cl)(F)F |
Computed by PubChem (NCBI)