CAS 375-48-4 appears in our catalog under these names: 1-Bromononafluorobutane, 97%, 1–Bromononafluorobutane. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 25g, 1g.
1-bromo-1,1,2,2,3,3,4,4,4-nonafluorobutane (CAS 375-48-4) is a chemical compound with the molecular formula C4BrF9 and a molecular weight of 298.93 g/mol. IUPAC name: 1-bromo-1,1,2,2,3,3,4,4,4-nonafluorobutane. InChIKey: CVEIKEYTQKDDQK-UHFFFAOYSA-N.
| Molecular formula | C4BrF9 |
|---|---|
| Molecular weight | 298.93 g/mol |
| IUPAC name | 1-bromo-1,1,2,2,3,3,4,4,4-nonafluorobutane |
| InChIKey | CVEIKEYTQKDDQK-UHFFFAOYSA-N |
| SMILES | C(C(C(F)(F)Br)(F)F)(C(F)(F)F)(F)F |
Computed by PubChem (NCBI)