CAS 375-72-4 appears in our catalog under these names: Nonafluorobutanesulfonyl fluoride, 97%, Nonafluoro-1-butanesulfonyl Fluoride, >95% (GC), Perfluoro–1–butanesulfonyl fluoride, Nonafluorobutanesulfonyl fluoride, 90+% , Nonafluoro butanesulfonyl fluoride. Offered by: Combi-blocks, TRC, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 100g, 25g, 500g, 5g, 10g, 1g, 50g, 1kg.
1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonyl fluoride (CAS 375-72-4) is a chemical compound with the molecular formula C4F10O2S and a molecular weight of 302.09 g/mol. IUPAC name: 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonyl fluoride. InChIKey: LUYQYZLEHLTPBH-UHFFFAOYSA-N.
| Molecular formula | C4F10O2S |
|---|---|
| Molecular weight | 302.09 g/mol |
| IUPAC name | 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonyl fluoride |
| InChIKey | LUYQYZLEHLTPBH-UHFFFAOYSA-N |
| SMILES | C(C(C(F)(F)S(=O)(=O)F)(F)F)(C(F)(F)F)(F)F |
Computed by PubChem (NCBI)