CAS 375-80-4 appears in our catalog under these names: 1,6-Diiodoperfluorohexane, 95%, 1,6-Diiodoperfluorohexane, >95% (GC), Dodecafluoro–1,6–diiodohexane, 1,6-Diiodoperfluorohexane, 97% , Dodecafluoro-1,6-diiodohexane, >98.0%(GC). Offered by: Combi-blocks, TRC, GLPBio, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 25g, 5g, 1g, 250mg, 10g, 2g.
1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-1,6-diiodohexane (CAS 375-80-4) is a chemical compound with the molecular formula C6F12I2 and a molecular weight of 553.85 g/mol. IUPAC name: 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-1,6-diiodohexane. InChIKey: JOQDDLBOAIKFQX-UHFFFAOYSA-N.
| Molecular formula | C6F12I2 |
|---|---|
| Molecular weight | 553.85 g/mol |
| IUPAC name | 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-1,6-diiodohexane |
| InChIKey | JOQDDLBOAIKFQX-UHFFFAOYSA-N |
| SMILES | C(C(C(C(F)(F)I)(F)F)(F)F)(C(C(F)(F)I)(F)F)(F)F |
Computed by PubChem (NCBI)