CAS 375-92-8 appears in our catalog under these names: Perfluoroheptanesulfonic acid, 95%, Perfluoroheptanesulfonic Acid, Perfluoroheptanesulfonic acid 100 µg/mL in Acetonitrile, Perfluoroheptanesulfonic acid, PERFLUORO-1-HEPTANESULFONIC ACID. Offered by: Combi-blocks, Chemat Brand, Dr. Ehrenstorfer, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, on request, 50mg, 1ml, 25mg, 5mg, 10mg.
1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptane-1-sulfonic acid (CAS 375-92-8) is a chemical compound with the molecular formula C7HF15O3S and a molecular weight of 450.12 g/mol. IUPAC name: 1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptane-1-sulfonic acid. InChIKey: OYGQVDSRYXATEL-UHFFFAOYSA-N.
| Molecular formula | C7HF15O3S |
|---|---|
| Molecular weight | 450.12 g/mol |
| IUPAC name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptane-1-sulfonic acid |
| InChIKey | OYGQVDSRYXATEL-UHFFFAOYSA-N |
| SMILES | C(C(C(C(F)(F)F)(F)F)(F)F)(C(C(C(F)(F)S(=O)(=O)O)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)