CAS 375-96-2 appears in our catalog under these names: Perfluorononane, 95%, Perfluorononane, Eicosafluorononane, Perfluorononane, 98%. Offered by: Combi-blocks, Dr. Ehrenstorfer, GLPBio, Biosynth, Chemat. Available pack sizes: 1g, 25g, 5g, 250mg, 50g, 100g.
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-icosafluorononane (CAS 375-96-2) is a chemical compound with the molecular formula C9F20 and a molecular weight of 488.06 g/mol. IUPAC name: 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-icosafluorononane. InChIKey: UVWPNDVAQBNQBG-UHFFFAOYSA-N.
| Molecular formula | C9F20 |
|---|---|
| Molecular weight | 488.06 g/mol |
| IUPAC name | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-icosafluorononane |
| InChIKey | UVWPNDVAQBNQBG-UHFFFAOYSA-N |
| SMILES | C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)