CAS 375-97-3 is the registry number for 1H-Perfluorodecane, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-henicosafluorodecane (CAS 375-97-3) is a chemical compound with the molecular formula C10HF21 and a molecular weight of 520.08 g/mol. IUPAC name: 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-henicosafluorodecane. InChIKey: DSNMEFYRPYNWJJ-UHFFFAOYSA-N.
| Molecular formula | C10HF21 |
|---|---|
| Molecular weight | 520.08 g/mol |
| IUPAC name | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-henicosafluorodecane |
| InChIKey | DSNMEFYRPYNWJJ-UHFFFAOYSA-N |
| SMILES | C(C(C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)