CAS 37514-39-9 appears in our catalog under these names: Sulfisozole, Sulfisozole sodium, 3-Sulfanilamidoisoxazole Sodium. Offered by: Chemat Brand, Dr. Ehrenstorfer, TRC, Biosynth. Available pack sizes: on request, 100mg, 25mg, 50mg.
Sodium (4-aminophenyl)sulfonyl-(1,2-oxazol-3-yl)azanide (CAS 37514-39-9) is a chemical compound with the molecular formula C9H8N3NaO3S and a molecular weight of 261.24 g/mol. IUPAC name: sodium (4-aminophenyl)sulfonyl-(1,2-oxazol-3-yl)azanide. InChIKey: ILJOTUZCTLKWTO-UHFFFAOYSA-N.
| Molecular formula | C9H8N3NaO3S |
|---|---|
| Molecular weight | 261.24 g/mol |
| IUPAC name | sodium (4-aminophenyl)sulfonyl-(1,2-oxazol-3-yl)azanide |
| InChIKey | ILJOTUZCTLKWTO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)S(=O)(=O)[N-]C2=NOC=C2.[Na+] |
Computed by PubChem (NCBI)