CAS 37517-78-5 appears in our catalog under these names: Magnesium 3–ethoxy–3–oxopropanoate, Magnesium 3-ethoxy-3-oxopropanoate, 95%, 95%, Magnesium 3-ethoxy-3-oxopropanoate, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg.
Magnesium bis(3-ethoxy-3-oxopropanoate) (CAS 37517-78-5) is a chemical compound with the molecular formula C10H14MgO8 and a molecular weight of 286.52 g/mol. IUPAC name: magnesium bis(3-ethoxy-3-oxopropanoate). InChIKey: DVWUPYHFVYOPNV-UHFFFAOYSA-L.
| Molecular formula | C10H14MgO8 |
|---|---|
| Molecular weight | 286.52 g/mol |
| IUPAC name | magnesium bis(3-ethoxy-3-oxopropanoate) |
| InChIKey | DVWUPYHFVYOPNV-UHFFFAOYSA-L |
| SMILES | CCOC(=O)CC(=O)[O-].CCOC(=O)CC(=O)[O-].[Mg+2] |
Computed by PubChem (NCBI)