CAS 37532-04-0 is the registry number for N'-(2,6-dichlorobenzylidene)-4-methylbenzenesulfonohydrazide, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
N-[(E)-(2,6-dichlorophenyl)methylideneamino]-4-methylbenzenesulfonamide (CAS 37532-04-0) is a chemical compound with the molecular formula C14H12Cl2N2O2S and a molecular weight of 343.2 g/mol. IUPAC name: N-[(E)-(2,6-dichlorophenyl)methylideneamino]-4-methylbenzenesulfonamide. InChIKey: VUMDYLMCBDTATC-RQZCQDPDSA-N.
| Molecular formula | C14H12Cl2N2O2S |
|---|---|
| Molecular weight | 343.2 g/mol |
| IUPAC name | N-[(E)-(2,6-dichlorophenyl)methylideneamino]-4-methylbenzenesulfonamide |
| InChIKey | VUMDYLMCBDTATC-RQZCQDPDSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N/N=C/C2=C(C=CC=C2Cl)Cl |
Computed by PubChem (NCBI)