CAS 375387-13-6 appears in our catalog under these names: 4-Aminotoluene-3-sulfonic acid nickel salt, 95%, Nickel(II) 4–Aminotoluene–3–sulfonate, Nickel(II) 2-Amino-5-methylbenzenesulfonate, >95.0%(T), 4-AMinotoluene-3-sulfonic acid nickel salt. Offered by: Combi-blocks, GLPBio, TCI, Chemat. Available pack sizes: 25g, 1g, 5g.
Bis(2-amino-5-methylbenzenesulfonate);nickel(2+) (CAS 375387-13-6) is a chemical compound with the molecular formula C14H16N2NiO6S2 and a molecular weight of 431.1 g/mol. IUPAC name: bis(2-amino-5-methylbenzenesulfonate);nickel(2+). InChIKey: JFVHHXOSEDMKHN-UHFFFAOYSA-L.
| Molecular formula | C14H16N2NiO6S2 |
|---|---|
| Molecular weight | 431.1 g/mol |
| IUPAC name | bis(2-amino-5-methylbenzenesulfonate);nickel(2+) |
| InChIKey | JFVHHXOSEDMKHN-UHFFFAOYSA-L |
| SMILES | CC1=CC(=C(C=C1)N)S(=O)(=O)[O-].CC1=CC(=C(C=C1)N)S(=O)(=O)[O-].[Ni+2] |
Computed by PubChem (NCBI)