CAS 3754-19-6 is the registry number for Ambuside. Offered by: TRC. Available pack sizes: 250mg.
4-chloro-6-(3-oxobut-1-enylamino)-1-N-prop-2-enylbenzene-1,3-disulfonamide (CAS 3754-19-6) is a chemical compound with the molecular formula C13H16ClN3O5S2 and a molecular weight of 393.9 g/mol. IUPAC name: 4-chloro-6-(3-oxobut-1-enylamino)-1-N-prop-2-enylbenzene-1,3-disulfonamide. InChIKey: LTSOENFXCPOCHG-UHFFFAOYSA-N.
| Molecular formula | C13H16ClN3O5S2 |
|---|---|
| Molecular weight | 393.9 g/mol |
| IUPAC name | 4-chloro-6-(3-oxobut-1-enylamino)-1-N-prop-2-enylbenzene-1,3-disulfonamide |
| InChIKey | LTSOENFXCPOCHG-UHFFFAOYSA-N |
| SMILES | CC(=O)C=CNC1=CC(=C(C=C1S(=O)(=O)NCC=C)S(=O)(=O)N)Cl |
Computed by PubChem (NCBI)