CAS 375822-19-8 is the registry number for D-Ala-Lys-AMCA. Offered by: Creative Peptides, Biosynth, MedChemExpress. Available pack sizes: on request, 50mg, 5mg, 10mg, 25mg, Get quote.
(2S)-6-[[2-(7-amino-4-methyl-2-oxochromen-3-yl)acetyl]amino]-2-[[(2R)-2-aminopropanoyl]amino]hexanoic acid (CAS 375822-19-8) is a chemical compound with the molecular formula C21H28N4O6 and a molecular weight of 432.5 g/mol. IUPAC name: (2S)-6-[[2-(7-amino-4-methyl-2-oxochromen-3-yl)acetyl]amino]-2-[[(2R)-2-aminopropanoyl]amino]hexanoic acid. InChIKey: JBMWHNASOBPJQQ-WBMJQRKESA-N.
| Molecular formula | C21H28N4O6 |
|---|---|
| Molecular weight | 432.5 g/mol |
| IUPAC name | (2S)-6-[[2-(7-amino-4-methyl-2-oxochromen-3-yl)acetyl]amino]-2-[[(2R)-2-aminopropanoyl]amino]hexanoic acid |
| InChIKey | JBMWHNASOBPJQQ-WBMJQRKESA-N |
| SMILES | CC1=C(C(=O)OC2=C1C=CC(=C2)N)CC(=O)NCCCC[C@@H](C(=O)O)NC(=O)[C@@H](C)N |
Computed by PubChem (NCBI)