Products 375826-84-9
CAS 375826-84-9 is the registry number for CN009543V, 99.37%. Offered by: MedChemExpress. Available pack sizes: 50 mg, 100 mg, 5 mg, 10mM/1mL, 10 mg, 25 mg.
Methyl 2-acetamido-3-[(7-nitro-2,1,3-benzoxadiazol-4-yl)sulfanyl]propanoate (CAS 375826-84-9) is a chemical compound with the molecular formula C12H12N4O6S and a molecular weight of 340.31 g/mol. IUPAC name: methyl 2-acetamido-3-[(7-nitro-2,1,3-benzoxadiazol-4-yl)sulfanyl]propanoate. InChIKey: RNWHWLQISXPJOJ-UHFFFAOYSA-N.
| Molecular formula | C12H12N4O6S |
|---|---|
| Molecular weight | 340.31 g/mol |
| IUPAC name | methyl 2-acetamido-3-[(7-nitro-2,1,3-benzoxadiazol-4-yl)sulfanyl]propanoate |
| InChIKey | RNWHWLQISXPJOJ-UHFFFAOYSA-N |
| SMILES | CC(=O)NC(CSC1=CC=C(C2=NON=C12)[N+](=O)[O-])C(=O)OC |
Computed by PubChem (NCBI)